What is the structural formula for C3H8O?
What is the structural formula for C3H8O?
C3H8O
Isopropyl alcohol/Formula
What is the structural formula of acetone?
C3H6O
Acetone/Formula
What is the chemical name of C3H8O?
isopropyl alcohol
Isopropyl alcohol/IUPAC ID
What is the name of c3 h6 O?
| IUPAC Name | propan-2-one |
|---|---|
| Alternative Names | 2-propanone propanone Dimethyl ketone |
| Molecular Formula | C3H6O |
| Molar Mass | 58.08 g/mol |
| InChI | InChI=1S/C3H6O/c1-3(2)4/h1-2H3 |
What is the condensed structural formula of ethanol?
Classification of Alcohols
| Condensed Structural Formula | Class of Alcohol | IUPAC Name |
|---|---|---|
| CH 3CH 2OH | primary | ethanol |
| CH 3CH 2CH 2OH | primary | 1-propanol |
| (CH 3) 2CHOH | secondary | 2-propanol |
| CH 3CH 2CH 2CH 2OH | primary | 1-butanol |
What is the number of structural isomers that may have the molecular formula C3H8O?
An easy example to consider is isomers of C3H8O. This molecular formula has three possible stable isomers, two alcohols and an ether.
What is the structural formula for 2 Methylpropane?
C4H10
Isobutane/Formula
Isobutane, also known as i-butane, 2-methylpropane or methylpropane, is a chemical compound with molecular formula HC(CH3)3. It is an isomer of butane. Isobutane is a colourless, odourless gas. It is the simplest alkane with a tertiary carbon atom.
Is propanol acidic or basic?
Its conjugate acid, 1-propanol, is a rather weak acid . Since its conjugate acid is the weakest (highest ), sodium propoxide is the strongest base.
What is the structural formula of c3 h6 O?
Acetone (C3H6O, CAS 67-64-1), also known as dimethyl ketone or 2-propanone, is the simplest ketone.
What is the condensed structural formula for benzaldehyde?
Benzaldehyde (C6H5CHO) is an organic compound consisting of a benzene ring with a formyl substituent.
What is the chemical formula for acetone and propanone?
Acetone consists of three carbon atoms, six hydrogen atoms, and one oxygen atom. It is considered as a ketone since there is a carbonyl group present in it. Thus, the chemical formula for acetone or propanone is written as-. Acetone Chemical Formula = C 3 H 6 O.
What is the formula for isopropyl alcohol C3H8O?
Isopropyl Alcohol – C3H8O What is Isopropyl Alcohol? Isopropyl alcohol commonly referred to as Isopropanol or n-propanol or dimethylcarbinol is a colourless and flammable liquid with the formula C 3 H 8 O. Isopropyl alcohol is widely employed in solvent applications.
What can C3H7OH and H2 be used for?
C3H7OH ➝ C3H6O (acetone) + H2 Used as a solvent and intermediate in the production of chemicals. In industry, it is used as a solvent for instant manufacture of cements, primers, paints and varnishes. Most commonly used as a disinfectant for wiping down the surfaces of furniture and shelves in the operating room.
Where can you find acetone in the body?
Acetone is mainly used in medicine and in cosmetics. Acetone is present in blood and in urine. Acetone is also an active ingredient in nail polish removers. Visit uses of acetone to learn more about its uses in different sectors. Put your understanding of this concept to test by answering a few MCQs.