What is the pKa of 1/4-Dimethoxybenzene?
What is the pKa of 1/4-Dimethoxybenzene?
-4.5
Structure for HMDB0029671 (1,4-Dimethoxybenzene)
| Property | Value | Source |
|---|---|---|
| logP | 1.66 | ChemAxon |
| logS | -2 | ALOGPS |
| pKa (Strongest Basic) | -4.5 | ChemAxon |
| Physiological Charge | 0 | ChemAxon |
What is the density of 1/4-Dimethoxybenzene?
790 kg/m³
1,4-Dimethoxybenzene/Density
What is the pKa of sodium hydroxide?
15.7
Structure for FDB015399 (Sodium hydroxide (NaOH))
| Property | Value | Source |
|---|---|---|
| logP | -0.77 | ChemAxon |
| pKa (Strongest Acidic) | 15.7 | ChemAxon |
| pKa (Strongest Basic) | -1.8 | ChemAxon |
| Physiological Charge | 0 | ChemAxon |
What is the molar mass of 1/4-Dimethoxybenzene?
138.1668 g/mol
1,4-Dimethoxybenzene/Molar mass
Can 1/4 Dimethoxybenzene react with NaOH?
Note that 1,4-dimethoxybenzene does not have any acidic proton and cannot react with either base. It will remain in the ether layer. Why is it a problem is you were to accidentally use the stronger base first?
How do you separate a binary mixture?
f) Result.
- Separation of Two Components from given Binary Mixture of Organic Compounds Qualitatively and.
- The solid-solid mixture and liquid – liquid mixture is identified directly by observation of the physical.
- is evaporated. If the liquid part gets evaporated and solid residue is left behind then the given mixture.
What is the chemical name for benzoic acid?
| IUPAC Name | benzoic acid |
|---|---|
| Alternative Names | benzenecarboxylic acid Carboxybenzene phenylformic acid |
| Molecular Formula | C7H6O2 |
| Molar Mass | 122.123 g/mol |
| InChI | InChI=1S/C7H6O2/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H,8,9) |
Is the chemical 1, 4 dimethoxybenzene a hazard?
Chemical: 1,4-dimethoxybenzene. Yellow triangle – The chemical has met Safer Choice Criteria for its functional ingredient-class, but has some hazard profile issues. Specifically, a chemical with this code is not associated with a low level of hazard concern for all human health and environmental endpoints.
What are the MSDS for hydroquinone dimethyl ether?
Material Safety Data Sheet 1,4-Dimethoxybenzene MSDS# 96018 Section 1 – Chemical Product and Company Identification MSDS Name: 1,4-Dimethoxybenzene Catalog Numbers: AC115410000, AC115410010, AC115410050, AC115411000, AC115415000, AC407880000 AC407880000, AC407880010, AC407882500, EK1023845, EK1023910 Synonyms: Hydroquinone dimethyl ether.
How is the alkylation of 1, 4 dimethoxybenzene done?
Reaction Procedure: 1. Weigh out 1.50 g of 1,4-dimethoxybenzene and place in a 125-mL Erlenmeyer flask. 2. Measure out 2.50 mL of warm t-butyl alcohol into a syringe, and inject into the Erlenmeyer flask. (Note: t-butanol freezes at 26ºC, so it’s best to handle it somewhat warm so it stays liquid.
Where can you find 1, 4 dimethoxybenzene in Peppermint?
1, 4-Dimethoxybenzene is found in peppermint. 1, 4-Dimethoxybenzene is a flavouring ingredien. Computed by LexiChem 2.6.6 (PubChem release 2019.06.18) Computed by InChI 1.0.5 (PubChem release 2019.06.18) Computed by InChI 1.0.5 (PubChem release 2019.06.18) Computed by OEChem 2.1.5 (PubChem release 2019.06.18) 1,4-Dimethoxybenzene.